C22H27N5O3S — CID 78869822
N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 78869822) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78869822 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H27N5O3S/c1-4-23-19-13-12-18(31(29,30)26(5-2)6-3)16-21(19)24-22(28)20-14-15-27(25-20)17-10-8-7-9-11-17/h7-16,23H,4-6H2,1-3H3,(H,24,28) |
| InChIKey | WKRIPVLBLKJYGS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |