C22H29NO7S — CID 3256259
3,4,5-trimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide (PubChem CID 3256259) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3256259 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide |
| SMILES | CCC(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C22H29NO7S/c1-7-15(8-2)31(25,26)16-9-10-18(27-3)17(13-16)23-22(24)14-11-19(28-4)21(30-6)20(12-14)29-5/h9-13,15H,7-8H2,1-6H3,(H,23,24) |
| InChIKey | CWCDFJMXHGVNDN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |