C26H27NO5S — CID 3256262
N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)-9H-xanthene-9-carboxamide (PubChem CID 3256262) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)-9H-xanthene-9-carboxamide.
| Compound Name | N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 3256262 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)-9H-xanthene-9-carboxamide |
| SMILES | CCC(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)C2c3ccccc3Oc3ccccc32)c1 |
| InChI | InChI=1S/C26H27NO5S/c1-4-17(5-2)33(29,30)18-14-15-24(31-3)21(16-18)27-26(28)25-19-10-6-8-12-22(19)32-23-13-9-7-11-20(23)25/h6-17,25H,4-5H2,1-3H3,(H,27,28) |
| InChIKey | NTIQZUXQJBBWRH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |