C21H27NO6S — CID 5170083
3,5-dimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide (PubChem CID 5170083) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 5170083 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3,5-dimethoxy-N-(2-methoxy-5-pentan-3-ylsulfonylphenyl)benzamide |
| SMILES | CCC(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C21H27NO6S/c1-6-17(7-2)29(24,25)18-8-9-20(28-5)19(13-18)22-21(23)14-10-15(26-3)12-16(11-14)27-4/h8-13,17H,6-7H2,1-5H3,(H,22,23) |
| InChIKey | DBWYVCTXOAGRJL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |