C20H24N2O5S — CID 17112879
N-[(2,5-dimethoxyphenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide (PubChem CID 17112879) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17112879 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-4-26-11-12-27-15-7-5-14(6-8-15)19(23)22-20(28)21-17-13-16(24-2)9-10-18(17)25-3/h5-10,13H,4,11-12H2,1-3H3,(H2,21,22,23,28) |
| InChIKey | SGBNDTMNDYOCRZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|