C19H23NO5 — CID 17139561
N-(2,5-dimethoxyphenyl)-3-(2-ethoxyethoxy)benzamide (PubChem CID 17139561) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(2-ethoxyethoxy)benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17139561 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1cccc(C(=O)Nc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C19H23NO5/c1-4-24-10-11-25-16-7-5-6-14(12-16)19(21)20-17-13-15(22-2)8-9-18(17)23-3/h5-9,12-13H,4,10-11H2,1-3H3,(H,20,21) |
| InChIKey | REIRPRAMEAYQOJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|