C21H22ClNO6 — CID 7133179
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate (PubChem CID 7133179) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7133179 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C21H22ClNO6/c1-3-28-16-7-4-14(5-8-16)18(24)9-11-21(26)29-13-20(25)23-17-12-15(22)6-10-19(17)27-2/h4-8,10,12H,3,9,11,13H2,1-2H3,(H,23,25) |
| InChIKey | XDDDKFAQMPWIPO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |