C20H19F2NO5 — CID 7133057
[2-(2,5-difluoroanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate (PubChem CID 7133057) has the molecular formula C20H19F2NO5 and a molecular weight of 391.37 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7133057 |
| Molecular Formula | C20H19F2NO5 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C20H19F2NO5/c1-2-27-15-6-3-13(4-7-15)18(24)9-10-20(26)28-12-19(25)23-17-11-14(21)5-8-16(17)22/h3-8,11H,2,9-10,12H2,1H3,(H,23,25) |
| InChIKey | PKYLSGXZEMBYRA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |