C31H29N3O4S — CID 43878045
3-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide (PubChem CID 43878045) has the molecular formula C31H29N3O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is 3-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 43878045 |
| Molecular Formula | C31H29N3O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 3-[[3-(2-phenoxyethoxy)benzoyl]carbamothioylamino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(NC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H29N3O4S/c1-22(23-10-4-2-5-11-23)32-29(35)24-12-8-14-26(20-24)33-31(39)34-30(36)25-13-9-17-28(21-25)38-19-18-37-27-15-6-3-7-16-27/h2-17,20-22H,18-19H2,1H3,(H,32,35)(H2,33,34,36,39) |
| InChIKey | HFOASHXGXPALID-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|