C20H23N3O3S — CID 17197743
3-[(3-ethoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide (PubChem CID 17197743) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(3-ethoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[(3-ethoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17197743 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-[(3-ethoxybenzoyl)carbamothioylamino]-N-propan-2-ylbenzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2cccc(C(=O)NC(C)C)c2)c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-4-26-17-10-6-8-15(12-17)19(25)23-20(27)22-16-9-5-7-14(11-16)18(24)21-13(2)3/h5-13H,4H2,1-3H3,(H,21,24)(H2,22,23,25,27) |
| InChIKey | OGXLNNCFTYUNOW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|