C24H22BrNO3 — CID 17086780
5-bromo-2-(2-phenylethoxy)-N-(3-prop-2-enoxyphenyl)benzamide (PubChem CID 17086780) has the molecular formula C24H22BrNO3 and a molecular weight of 452.35 g/mol. Its IUPAC name is 5-bromo-2-(2-phenylethoxy)-N-(3-prop-2-enoxyphenyl)benzamide.
| Compound Name | 5-bromo-2-(2-phenylethoxy)-N-(3-prop-2-enoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17086780 |
| Molecular Formula | C24H22BrNO3 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-bromo-2-(2-phenylethoxy)-N-(3-prop-2-enoxyphenyl)benzamide |
| SMILES | C=CCOc1cccc(NC(=O)c2cc(Br)ccc2OCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H22BrNO3/c1-2-14-28-21-10-6-9-20(17-21)26-24(27)22-16-19(25)11-12-23(22)29-15-13-18-7-4-3-5-8-18/h2-12,16-17H,1,13-15H2,(H,26,27) |
| InChIKey | ZMVPPLIDLNEEIW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|