C18H24Cl2N2O4S — CID 11618939
(3S)-1-(3,5-dichlorophenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide (PubChem CID 11618939) has the molecular formula C18H24Cl2N2O4S and a molecular weight of 435.37 g/mol. Its IUPAC name is (3S)-1-(3,5-dichlorophenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(3,5-dichlorophenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11618939 |
| Molecular Formula | C18H24Cl2N2O4S |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | (3S)-1-(3,5-dichlorophenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC(O)C1)[C@H]1CCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C18H24Cl2N2O4S/c19-13-7-14(20)9-17(8-13)27(25,26)22-6-2-3-12(11-22)18(24)21-15-4-1-5-16(23)10-15/h7-9,12,15-16,23H,1-6,10-11H2,(H,21,24)/t12-,15?,16?/m0/s1 |
| InChIKey | CKPALIIJIMQJKM-JQRITLKVSA-N |
| XLogP | 2.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |