C19H27ClN2O4S — CID 69263233
1-(3-chloro-2-methylphenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide (PubChem CID 69263233) has the molecular formula C19H27ClN2O4S and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide.
| Compound Name | 1-(3-chloro-2-methylphenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 69263233 |
| Molecular Formula | C19H27ClN2O4S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)sulfonyl-N-(3-hydroxycyclohexyl)piperidine-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCCC(C(=O)NC2CCCC(O)C2)C1 |
| InChI | InChI=1S/C19H27ClN2O4S/c1-13-17(20)8-3-9-18(13)27(25,26)22-10-4-5-14(12-22)19(24)21-15-6-2-7-16(23)11-15/h3,8-9,14-16,23H,2,4-7,10-12H2,1H3,(H,21,24) |
| InChIKey | HJCYOZMOXVXMGM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |