C22H31N3O4S — CID 41062070
(3R)-N-cyclohexyl-1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 41062070) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41062070 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (3R)-N-cyclohexyl-1-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CCCN(S(=O)(=O)c2ccc(N3CCCC3=O)cc2)C1 |
| InChI | InChI=1S/C22H31N3O4S/c26-21-9-5-15-25(21)19-10-12-20(13-11-19)30(28,29)24-14-4-6-17(16-24)22(27)23-18-7-2-1-3-8-18/h10-13,17-18H,1-9,14-16H2,(H,23,27)/t17-/m1/s1 |
| InChIKey | ZPZUJCWJNOJLCP-QGZVFWFLSA-N |
| XLogP | 2.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |