C11H12BrNO2 — CID 43133406
N-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 43133406) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 43133406 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | N-(2-bromoethyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCBr)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C11H12BrNO2/c12-5-6-13-11(14)10-7-8-3-1-2-4-9(8)15-10/h1-4,10H,5-7H2,(H,13,14) |
| InChIKey | RFCDGDTXEUABSY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|