C16H20BrNO2 — CID 106134784
N-[(4-bromocyclohexyl)methyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 106134784) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[(4-bromocyclohexyl)methyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(4-bromocyclohexyl)methyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 106134784 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[(4-bromocyclohexyl)methyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC1CCC(Br)CC1)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H20BrNO2/c17-13-7-5-11(6-8-13)10-18-16(19)15-9-12-3-1-2-4-14(12)20-15/h1-4,11,13,15H,5-10H2,(H,18,19) |
| InChIKey | ZQNOXFAJJRLSEA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|