C12H14BrNO2 — CID 43133562
N-(3-bromopropyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 43133562) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is N-(3-bromopropyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-bromopropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 43133562 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-(3-bromopropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCCBr)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H14BrNO2/c13-6-3-7-14-12(15)11-8-9-4-1-2-5-10(9)16-11/h1-2,4-5,11H,3,6-8H2,(H,14,15) |
| InChIKey | HYQPVCYJVCWWIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|