About [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate
[4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate (PubChem CID 153268140) has the molecular formula C21H20O8
and a molecular weight of 400.38 g/mol. Its IUPAC name is [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate.
Molecular Properties
| Compound Name | [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate |
| PubChem CID | 153268140 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate |
| SMILES | O=C(OCC1CO1)Oc1ccc(Cc2ccc(OC(=O)OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C21H20O8/c22-20(26-12-18-10-24-18)28-16-5-1-14(2-6-16)9-15-3-7-17(8-4-15)29-21(23)27-13-19-11-25-19/h1-8,18-19H,9-13H2 |
| InChIKey | WWOYFEBLYSXORR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate?
The IUPAC name of [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate (CID 153268140) is [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate.
What is the SMILES notation for [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate?
The canonical SMILES for [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate is O=C(OCC1CO1)Oc1ccc(Cc2ccc(OC(=O)OCC3CO3)cc2)cc1.
What is the InChIKey of [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate?
The InChIKey is WWOYFEBLYSXORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O8/c22-20(26-12-18-10-24-18)28-16-5-1-14(2-6-16)9-15-3-7-17(8-4-15)29-21(23)27-13-19-11-25-19/h1-8,18-19H,9-13H2.
What are the key properties of [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate?
[4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate has a molecular weight of 400.38 g/mol, XLogP of 3.11, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(oxiran-2-ylmethoxycarbonyloxy)phenyl]methyl]phenyl] oxiran-2-ylmethyl carbonate is sourced from PubChem (CID 153268140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).