C25H22N4O3 — CID 54473703
(2,3-dicyano-4-propoxyphenyl) 4-(5-propylpyrimidin-2-yl)benzoate (PubChem CID 54473703) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is (2,3-dicyano-4-propoxyphenyl) 4-(5-propylpyrimidin-2-yl)benzoate.
| Compound Name | (2,3-dicyano-4-propoxyphenyl) 4-(5-propylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 54473703 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (2,3-dicyano-4-propoxyphenyl) 4-(5-propylpyrimidin-2-yl)benzoate |
| SMILES | CCCOc1ccc(OC(=O)c2ccc(-c3ncc(CCC)cn3)cc2)c(C#N)c1C#N |
| InChI | InChI=1S/C25H22N4O3/c1-3-5-17-15-28-24(29-16-17)18-6-8-19(9-7-18)25(30)32-23-11-10-22(31-12-4-2)20(13-26)21(23)14-27/h6-11,15-16H,3-5,12H2,1-2H3 |
| InChIKey | XKBQZMKAAQAGAD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 108.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|