About 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate
7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate (PubChem CID 20607665) has the molecular formula C24H25NO5
and a molecular weight of 407.47 g/mol. Its IUPAC name is 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate.
Molecular Properties
| Compound Name | 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate |
| PubChem CID | 20607665 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate |
| SMILES | N#Cc1ccc(OC(=O)c2ccc(CCCCCCCOC(=O)C3CO3)cc2)cc1 |
| InChI | InChI=1S/C24H25NO5/c25-16-19-9-13-21(14-10-19)30-23(26)20-11-7-18(8-12-20)6-4-2-1-3-5-15-28-24(27)22-17-29-22/h7-14,22H,1-6,15,17H2 |
| InChIKey | QZUDIXAJCRVAHL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate?
The IUPAC name of 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate (CID 20607665) is 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate.
What is the SMILES notation for 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate?
The canonical SMILES for 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate is N#Cc1ccc(OC(=O)c2ccc(CCCCCCCOC(=O)C3CO3)cc2)cc1.
What is the InChIKey of 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate?
The InChIKey is QZUDIXAJCRVAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO5/c25-16-19-9-13-21(14-10-19)30-23(26)20-11-7-18(8-12-20)6-4-2-1-3-5-15-28-24(27)22-17-29-22/h7-14,22H,1-6,15,17H2.
What are the key properties of 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate?
7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate has a molecular weight of 407.47 g/mol, XLogP of 4.21, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(4-cyanophenoxy)carbonylphenyl]heptyl oxirane-2-carboxylate is sourced from PubChem (CID 20607665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).