C57H54N2O7 — CID 160506172
7-[4-[2-(6-cyanonaphthalen-2-yl)ethynyl]phenyl]heptyl oxirane-2-carboxylate;(6-cyanonaphthalen-2-yl) 4-(7-prop-2-enoyloxyheptyl)benzoate (PubChem CID 160506172) has the molecular formula C57H54N2O7 and a molecular weight of 879.07 g/mol. Its IUPAC name is 7-[4-[2-(6-cyanonaphthalen-2-yl)ethynyl]phenyl]heptyl oxirane-2-carboxylate;(6-cyanonaphthalen-2-yl) 4-(7-prop-2-enoyloxyheptyl)benzoate.
| Compound Name | 7-[4-[2-(6-cyanonaphthalen-2-yl)ethynyl]phenyl]heptyl oxirane-2-carboxylate;(6-cyanonaphthalen-2-yl) 4-(7-prop-2-enoyloxyheptyl)benzoate |
|---|---|
| PubChem CID | 160506172 |
| Molecular Formula | C57H54N2O7 |
| Molecular Weight | 879.07 g/mol |
| Exact Mass | 878.39 |
| IUPAC Name | 7-[4-[2-(6-cyanonaphthalen-2-yl)ethynyl]phenyl]heptyl oxirane-2-carboxylate;(6-cyanonaphthalen-2-yl) 4-(7-prop-2-enoyloxyheptyl)benzoate |
| SMILES | C=CC(=O)OCCCCCCCc1ccc(C(=O)Oc2ccc3cc(C#N)ccc3c2)cc1.N#Cc1ccc2cc(C#Cc3ccc(CCCCCCCOC(=O)C4CO4)cc3)ccc2c1 |
| InChI | InChI=1S/C29H27NO3.C28H27NO4/c30-20-25-14-16-26-18-24(13-15-27(26)19-25)12-11-23-9-7-22(8-10-23)6-4-2-1-3-5-17-32-29(31)28-21-33-28;1-2-27(30)32-17-7-5-3-4-6-8-21-9-12-23(13-10-21)28(31)33-26-16-15-24-18-22(20-29)11-14-25(24)19-26/h7-10,13-16,18-19,28H,1-6,17,21H2;2,9-16,18-19H,1,3-8,17H2 |
| InChIKey | QSKYJJXOTQUHHV-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 139.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.07 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|