About [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate
[4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate (PubChem CID 21246931) has the molecular formula C30H37BrN2O3
and a molecular weight of 553.54 g/mol. Its IUPAC name is [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate.
Molecular Properties
| Compound Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate |
| PubChem CID | 21246931 |
| Molecular Formula | C30H37BrN2O3 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(OCCCCCC)c(Br)c3)cc2)nc1 |
| InChI | InChI=1S/C30H37BrN2O3/c1-3-5-7-9-10-12-23-21-32-29(33-22-23)24-13-16-26(17-14-24)36-30(34)25-15-18-28(27(31)20-25)35-19-11-8-6-4-2/h13-18,20-22H,3-12,19H2,1-2H3 |
| InChIKey | NVLVZRNQOCQLAF-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate?
The IUPAC name of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate (CID 21246931) is [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate.
What is the SMILES notation for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate?
The canonical SMILES for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate is CCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(OCCCCCC)c(Br)c3)cc2)nc1.
What is the InChIKey of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate?
The InChIKey is NVLVZRNQOCQLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37BrN2O3/c1-3-5-7-9-10-12-23-21-32-29(33-22-23)24-13-16-26(17-14-24)36-30(34)25-15-18-28(27(31)20-25)35-19-11-8-6-4-2/h13-18,20-22H,3-12,19H2,1-2H3.
What are the key properties of [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate?
[4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate has a molecular weight of 553.54 g/mol, XLogP of 8.60, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-heptylpyrimidin-2-yl)phenyl] 3-bromo-4-hexoxybenzoate is sourced from PubChem (CID 21246931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).