About [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate
[4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate (PubChem CID 21246999) has the molecular formula C33H43BrN2O3
and a molecular weight of 595.62 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate.
Molecular Properties
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate |
| PubChem CID | 21246999 |
| Molecular Formula | C33H43BrN2O3 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCC)cn3)cc2)cc1Br |
| InChI | InChI=1S/C33H43BrN2O3/c1-3-5-7-9-11-13-15-26-24-35-32(36-25-26)27-16-19-29(20-17-27)39-33(37)28-18-21-31(30(34)23-28)38-22-14-12-10-8-6-4-2/h16-21,23-25H,3-15,22H2,1-2H3 |
| InChIKey | GENJQXSJZOYSTA-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate?
The IUPAC name of [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate (CID 21246999) is [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate.
What is the SMILES notation for [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate?
The canonical SMILES for [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate is CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCCCCC)cn3)cc2)cc1Br.
What is the InChIKey of [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate?
The InChIKey is GENJQXSJZOYSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H43BrN2O3/c1-3-5-7-9-11-13-15-26-24-35-32(36-25-26)27-16-19-29(20-17-27)39-33(37)28-18-21-31(30(34)23-28)38-22-14-12-10-8-6-4-2/h16-21,23-25H,3-15,22H2,1-2H3.
What are the key properties of [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate?
[4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate has a molecular weight of 595.62 g/mol, XLogP of 9.77, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-octylpyrimidin-2-yl)phenyl] 3-bromo-4-octoxybenzoate is sourced from PubChem (CID 21246999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).