C38H42N2O2S — CID 101215510
2,5-bis[2-(4-octoxyphenyl)ethynyl]thiophene-3,4-dicarbonitrile (PubChem CID 101215510) has the molecular formula C38H42N2O2S and a molecular weight of 590.83 g/mol. Its IUPAC name is 2,5-bis[2-(4-octoxyphenyl)ethynyl]thiophene-3,4-dicarbonitrile.
| Compound Name | 2,5-bis[2-(4-octoxyphenyl)ethynyl]thiophene-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 101215510 |
| Molecular Formula | C38H42N2O2S |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 2,5-bis[2-(4-octoxyphenyl)ethynyl]thiophene-3,4-dicarbonitrile |
| SMILES | CCCCCCCCOc1ccc(C#Cc2sc(C#Cc3ccc(OCCCCCCCC)cc3)c(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C38H42N2O2S/c1-3-5-7-9-11-13-27-41-33-21-15-31(16-22-33)19-25-37-35(29-39)36(30-40)38(43-37)26-20-32-17-23-34(24-18-32)42-28-14-12-10-8-6-4-2/h15-18,21-24H,3-14,27-28H2,1-2H3 |
| InChIKey | AQXMNJYLAQCORV-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|