C35H48Cl2O7Si3 — CID 59428901
(4-chlorophenyl) 2-chloro-4-[4-[8-[methyl-bis(trimethylsilyloxy)silyl]octoxy]benzoyl]oxybenzoate (PubChem CID 59428901) has the molecular formula C35H48Cl2O7Si3 and a molecular weight of 735.93 g/mol. Its IUPAC name is (4-chlorophenyl) 2-chloro-4-[4-[8-[methyl-bis(trimethylsilyloxy)silyl]octoxy]benzoyl]oxybenzoate.
| Compound Name | (4-chlorophenyl) 2-chloro-4-[4-[8-[methyl-bis(trimethylsilyloxy)silyl]octoxy]benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 59428901 |
| Molecular Formula | C35H48Cl2O7Si3 |
| Molecular Weight | 735.93 g/mol |
| Exact Mass | 734.21 |
| IUPAC Name | (4-chlorophenyl) 2-chloro-4-[4-[8-[methyl-bis(trimethylsilyloxy)silyl]octoxy]benzoyl]oxybenzoate |
| SMILES | C[Si](C)(C)O[Si](C)(CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(Cl)cc3)c(Cl)c2)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C35H48Cl2O7Si3/c1-45(2,3)43-47(7,44-46(4,5)6)25-13-11-9-8-10-12-24-40-29-18-14-27(15-19-29)34(38)42-31-22-23-32(33(37)26-31)35(39)41-30-20-16-28(36)17-21-30/h14-23,26H,8-13,24-25H2,1-7H3 |
| InChIKey | SGPJXXYOYVOEPC-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.93 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|