C28H30O2 — CID 145377014
[4-[4-(2-methylbutyl)phenyl]phenyl] (E)-3-(4-ethylphenyl)prop-2-enoate (PubChem CID 145377014) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is [4-[4-(2-methylbutyl)phenyl]phenyl] (E)-3-(4-ethylphenyl)prop-2-enoate.
| Compound Name | [4-[4-(2-methylbutyl)phenyl]phenyl] (E)-3-(4-ethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145377014 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [4-[4-(2-methylbutyl)phenyl]phenyl] (E)-3-(4-ethylphenyl)prop-2-enoate |
| SMILES | CCc1ccc(/C=C/C(=O)Oc2ccc(-c3ccc(CC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H30O2/c1-4-21(3)20-24-10-13-25(14-11-24)26-15-17-27(18-16-26)30-28(29)19-12-23-8-6-22(5-2)7-9-23/h6-19,21H,4-5,20H2,1-3H3/b19-12+ |
| InChIKey | JXWKQPSHEXBSAU-XDHOZWIPSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|