About [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride
[4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride (PubChem CID 170892566) has the molecular formula C19H26Cl2N2O4
and a molecular weight of 417.33 g/mol. Its IUPAC name is [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride.
Molecular Properties
| Compound Name | [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride |
| PubChem CID | 170892566 |
| Molecular Formula | C19H26Cl2N2O4 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride |
| SMILES | CC(Cc1ccc(OC(=O)c2ccc(CC(C)NO)cc2)cc1)NO.Cl.Cl |
| InChI | InChI=1S/C19H24N2O4.2ClH/c1-13(20-23)11-15-3-7-17(8-4-15)19(22)25-18-9-5-16(6-10-18)12-14(2)21-24;;/h3-10,13-14,20-21,23-24H,11-12H2,1-2H3;2*1H |
| InChIKey | VGLZGYXIAAMFQN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride?
The IUPAC name of [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride (CID 170892566) is [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride.
What is the SMILES notation for [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride?
The canonical SMILES for [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride is CC(Cc1ccc(OC(=O)c2ccc(CC(C)NO)cc2)cc1)NO.Cl.Cl.
What is the InChIKey of [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride?
The InChIKey is VGLZGYXIAAMFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4.2ClH/c1-13(20-23)11-15-3-7-17(8-4-15)19(22)25-18-9-5-16(6-10-18)12-14(2)21-24;;/h3-10,13-14,20-21,23-24H,11-12H2,1-2H3;2*1H.
What are the key properties of [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride?
[4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride has a molecular weight of 417.33 g/mol, XLogP of 3.57, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(hydroxyamino)propyl]phenyl] 4-[2-(hydroxyamino)propyl]benzoate;dihydrochloride is sourced from PubChem (CID 170892566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).