About [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate
[4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate (PubChem CID 21246904) has the molecular formula C35H45N3O2
and a molecular weight of 539.76 g/mol. Its IUPAC name is [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate.
Molecular Properties
| Compound Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate |
| PubChem CID | 21246904 |
| Molecular Formula | C35H45N3O2 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)c(C#N)c3)cc2)nc1 |
| InChI | InChI=1S/C35H45N3O2/c1-3-5-7-9-11-12-14-16-28-26-37-34(38-27-28)30-20-22-33(23-21-30)40-35(39)31-19-18-29(32(24-31)25-36)17-15-13-10-8-6-4-2/h18-24,26-27H,3-17H2,1-2H3 |
| InChIKey | FLDUQZJXVYBZLE-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate?
The IUPAC name of [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate (CID 21246904) is [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate.
What is the SMILES notation for [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate?
The canonical SMILES for [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate is CCCCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)c(C#N)c3)cc2)nc1.
What is the InChIKey of [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate?
The InChIKey is FLDUQZJXVYBZLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H45N3O2/c1-3-5-7-9-11-12-14-16-28-26-37-34(38-27-28)30-20-22-33(23-21-30)40-35(39)31-19-18-29(32(24-31)25-36)17-15-13-10-8-6-4-2/h18-24,26-27H,3-17H2,1-2H3.
What are the key properties of [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate?
[4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate has a molecular weight of 539.76 g/mol, XLogP of 9.43, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-nonylpyrimidin-2-yl)phenyl] 3-cyano-4-octylbenzoate is sourced from PubChem (CID 21246904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).