C50H64N2O10 — CID 136884093
[3-hydroxy-4-(octyliminomethyl)phenyl] 4-[2-[2-[2-[4-[3-hydroxy-4-(octyliminomethyl)phenoxy]carbonylphenoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 136884093) has the molecular formula C50H64N2O10 and a molecular weight of 853.07 g/mol. Its IUPAC name is [3-hydroxy-4-(octyliminomethyl)phenyl] 4-[2-[2-[2-[4-[3-hydroxy-4-(octyliminomethyl)phenoxy]carbonylphenoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | [3-hydroxy-4-(octyliminomethyl)phenyl] 4-[2-[2-[2-[4-[3-hydroxy-4-(octyliminomethyl)phenoxy]carbonylphenoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 136884093 |
| Molecular Formula | C50H64N2O10 |
| Molecular Weight | 853.07 g/mol |
| Exact Mass | 852.46 |
| IUPAC Name | [3-hydroxy-4-(octyliminomethyl)phenyl] 4-[2-[2-[2-[4-[3-hydroxy-4-(octyliminomethyl)phenoxy]carbonylphenoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | CCCCCCCC/N=C/c1ccc(OC(=O)c2ccc(OCCOCCOCCOc3ccc(C(=O)Oc4ccc(/C=N/CCCCCCCC)c(O)c4)cc3)cc2)cc1O |
| InChI | InChI=1S/C50H64N2O10/c1-3-5-7-9-11-13-27-51-37-41-19-25-45(35-47(41)53)61-49(55)39-15-21-43(22-16-39)59-33-31-57-29-30-58-32-34-60-44-23-17-40(18-24-44)50(56)62-46-26-20-42(48(54)36-46)38-52-28-14-12-10-8-6-4-2/h15-26,35-38,53-54H,3-14,27-34H2,1-2H3/b51-37+,52-38+ |
| InChIKey | SWCLZRCRBGAALH-KKEORWHISA-N |
| XLogP | 10.59 |
| TPSA | 154.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.07 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|