C25H24N2O6 — CID 4197792
[4-[(2-hydroxy-3-nitrophenyl)methylideneamino]phenyl] 4-pentoxybenzoate (PubChem CID 4197792) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [4-[(2-hydroxy-3-nitrophenyl)methylideneamino]phenyl] 4-pentoxybenzoate.
| Compound Name | [4-[(2-hydroxy-3-nitrophenyl)methylideneamino]phenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 4197792 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [4-[(2-hydroxy-3-nitrophenyl)methylideneamino]phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3cccc([N+](=O)[O-])c3O)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-2-3-4-16-32-21-12-8-18(9-13-21)25(29)33-22-14-10-20(11-15-22)26-17-19-6-5-7-23(24(19)28)27(30)31/h5-15,17,28H,2-4,16H2,1H3/b26-17+ |
| InChIKey | SVZHPHMWHVHHTJ-YZSQISJMSA-N |
| XLogP | 5.84 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|