C25H25BrN2O3 — CID 122213967
(3-bromophenyl) 4-[(4-hexoxyphenyl)diazenyl]benzoate (PubChem CID 122213967) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is (3-bromophenyl) 4-[(4-hexoxyphenyl)diazenyl]benzoate.
| Compound Name | (3-bromophenyl) 4-[(4-hexoxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 122213967 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (3-bromophenyl) 4-[(4-hexoxyphenyl)diazenyl]benzoate |
| SMILES | CCCCCCOc1ccc(/N=N/c2ccc(C(=O)Oc3cccc(Br)c3)cc2)cc1 |
| InChI | InChI=1S/C25H25BrN2O3/c1-2-3-4-5-17-30-23-15-13-22(14-16-23)28-27-21-11-9-19(10-12-21)25(29)31-24-8-6-7-20(26)18-24/h6-16,18H,2-5,17H2,1H3/b28-27+ |
| InChIKey | GQNILBSYHNVTMS-BYYHNAKLSA-N |
| XLogP | 8.04 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|