C20H25ClN2O2 — CID 136799593
2-[(4-chlorophenyl)diazenyl]-5-octoxyphenol (PubChem CID 136799593) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)diazenyl]-5-octoxyphenol.
| Compound Name | 2-[(4-chlorophenyl)diazenyl]-5-octoxyphenol |
|---|---|
| PubChem CID | 136799593 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(4-chlorophenyl)diazenyl]-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2ccc(Cl)cc2)c(O)c1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-2-3-4-5-6-7-14-25-18-12-13-19(20(24)15-18)23-22-17-10-8-16(21)9-11-17/h8-13,15,24H,2-7,14H2,1H3/b23-22+ |
| InChIKey | IROMJWILMVSSAM-GHVJWSGMSA-N |
| XLogP | 7.20 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|