C19H20BrNO3 — CID 71820762
[2-[(2-bromophenyl)methylamino]-2-oxoethyl] 4-propan-2-ylbenzoate (PubChem CID 71820762) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 4-propan-2-ylbenzoate.
| Compound Name | [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 71820762 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)OCC(=O)NCc2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H20BrNO3/c1-13(2)14-7-9-15(10-8-14)19(23)24-12-18(22)21-11-16-5-3-4-6-17(16)20/h3-10,13H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | MCLFVTBZCLUNSV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |