C21H30N2O6 — CID 34321831
ethyl 4-[[2-(4-butoxybenzoyl)oxyacetyl]amino]piperidine-1-carboxylate (PubChem CID 34321831) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 4-[[2-(4-butoxybenzoyl)oxyacetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-butoxybenzoyl)oxyacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 34321831 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethyl 4-[[2-(4-butoxybenzoyl)oxyacetyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)NC2CCN(C(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O6/c1-3-5-14-28-18-8-6-16(7-9-18)20(25)29-15-19(24)22-17-10-12-23(13-11-17)21(26)27-4-2/h6-9,17H,3-5,10-15H2,1-2H3,(H,22,24) |
| InChIKey | WMVAYTSZPOPQLE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|