C14H13N3O7 — CID 16961857
[2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 16961857) has the molecular formula C14H13N3O7 and a molecular weight of 335.27 g/mol. Its IUPAC name is [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 16961857 |
| Molecular Formula | C14H13N3O7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2cc(C)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N3O7/c1-8-5-13(24-16-8)15-12(18)7-23-14(19)9-3-4-11(22-2)10(6-9)17(20)21/h3-6H,7H2,1-2H3,(H,15,18) |
| InChIKey | ADVLTDAWDHYYEG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|