C13H10F3N3O5 — CID 99841855
N-(3-methyl-1,2-oxazol-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 99841855) has the molecular formula C13H10F3N3O5 and a molecular weight of 345.23 g/mol. Its IUPAC name is N-(3-methyl-1,2-oxazol-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(3-methyl-1,2-oxazol-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 99841855 |
| Molecular Formula | C13H10F3N3O5 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(3-methyl-1,2-oxazol-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(C(F)(F)F)cc2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C13H10F3N3O5/c1-7-4-12(24-18-7)17-11(20)6-23-10-3-2-8(13(14,15)16)5-9(10)19(21)22/h2-5H,6H2,1H3,(H,17,20) |
| InChIKey | CNHQQELFELZSNE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|