C13H15N5O4S — CID 56772747
ethyl 4-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 56772747) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is ethyl 4-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | ethyl 4-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 56772747 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | ethyl 4-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(Sc2nnc(CC)n2N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N5O4S/c1-3-11-15-16-13(17(11)14)23-10-6-5-8(12(19)22-4-2)7-9(10)18(20)21/h5-7H,3-4,14H2,1-2H3 |
| InChIKey | JIIPDVFFKSARQL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|