C10H9N5O4S — CID 56772758
methyl 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 56772758) has the molecular formula C10H9N5O4S and a molecular weight of 295.28 g/mol. Its IUPAC name is methyl 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | methyl 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 56772758 |
| Molecular Formula | C10H9N5O4S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | methyl 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(Sc2nncn2N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N5O4S/c1-19-9(16)6-2-3-8(7(4-6)15(17)18)20-10-13-12-5-14(10)11/h2-5H,11H2,1H3 |
| InChIKey | JXLGCSBYYRSOTE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|