C9H9N5O3S — CID 56772697
3-(2-methoxy-4-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine (PubChem CID 56772697) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is 3-(2-methoxy-4-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-methoxy-4-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 56772697 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-(2-methoxy-4-nitrophenyl)sulfanyl-1,2,4-triazol-4-amine |
| SMILES | COc1cc([N+](=O)[O-])ccc1Sc1nncn1N |
| InChI | InChI=1S/C9H9N5O3S/c1-17-7-4-6(14(15)16)2-3-8(7)18-9-12-11-5-13(9)10/h2-5H,10H2,1H3 |
| InChIKey | USVWXXHCKHOXSK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|