C10H12N6O2S — CID 133369452
3-ethyl-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine (PubChem CID 133369452) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-ethyl-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-ethyl-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 133369452 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-ethyl-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine |
| SMILES | CCc1nnc(Sc2ccc([N+](=O)[O-])c(C)n2)n1N |
| InChI | InChI=1S/C10H12N6O2S/c1-3-8-13-14-10(15(8)11)19-9-5-4-7(16(17)18)6(2)12-9/h4-5H,3,11H2,1-2H3 |
| InChIKey | WIQNHFBBSBXHEU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|