C12H10N6O3S — CID 133374365
3-(furan-2-yl)-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine (PubChem CID 133374365) has the molecular formula C12H10N6O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(furan-2-yl)-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 133374365 |
| Molecular Formula | C12H10N6O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-(furan-2-yl)-5-[(6-methyl-5-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1nc(Sc2nnc(-c3ccco3)n2N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N6O3S/c1-7-8(18(19)20)4-5-10(14-7)22-12-16-15-11(17(12)13)9-3-2-6-21-9/h2-6H,13H2,1H3 |
| InChIKey | DEPHCRSALGYKID-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|