C18H17NO7S — CID 2620337
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2620337) has the molecular formula C18H17NO7S and a molecular weight of 391.40 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2620337 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17NO7S/c1-11-4-6-13(7-5-11)17(20)12(2)26-18(21)14-8-9-16(27(3,24)25)15(10-14)19(22)23/h4-10,12H,1-3H3/t12-/m1/s1 |
| InChIKey | SPPNAONENRAWKI-GFCCVEGCSA-N |
| XLogP | 2.73 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|