C20H22N2O9S — CID 2475964
ethyl 2,4-dimethyl-5-[(2R)-2-(4-methylsulfonyl-3-nitrobenzoyl)oxypropanoyl]-1H-pyrrole-3-carboxylate (PubChem CID 2475964) has the molecular formula C20H22N2O9S and a molecular weight of 466.47 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[(2R)-2-(4-methylsulfonyl-3-nitrobenzoyl)oxypropanoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[(2R)-2-(4-methylsulfonyl-3-nitrobenzoyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2475964 |
| Molecular Formula | C20H22N2O9S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[(2R)-2-(4-methylsulfonyl-3-nitrobenzoyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C20H22N2O9S/c1-6-30-20(25)16-10(2)17(21-11(16)3)18(23)12(4)31-19(24)13-7-8-15(32(5,28)29)14(9-13)22(26)27/h7-9,12,21H,6H2,1-5H3/t12-/m1/s1 |
| InChIKey | XTDJJDDCBWWVPO-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 162.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|