C13H7BCl3NO6 — CID 21088111
[3-nitro-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid (PubChem CID 21088111) has the molecular formula C13H7BCl3NO6 and a molecular weight of 390.37 g/mol. Its IUPAC name is [3-nitro-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid.
| Compound Name | [3-nitro-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid |
|---|---|
| PubChem CID | 21088111 |
| Molecular Formula | C13H7BCl3NO6 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | [3-nitro-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7BCl3NO6/c15-8-4-10(16)12(11(17)5-8)24-13(19)6-1-7(14(20)21)3-9(2-6)18(22)23/h1-5,20-21H |
| InChIKey | MHNAQSAGPZOHHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|