C20H10B2Cl4N2O12 — CID 11319638
[3-[4-(3-borono-5-nitrobenzoyl)oxy-2,3,5,6-tetrachlorophenoxy]carbonyl-5-nitrophenyl]boronic acid (PubChem CID 11319638) has the molecular formula C20H10B2Cl4N2O12 and a molecular weight of 633.74 g/mol. Its IUPAC name is [3-[4-(3-borono-5-nitrobenzoyl)oxy-2,3,5,6-tetrachlorophenoxy]carbonyl-5-nitrophenyl]boronic acid.
| Compound Name | [3-[4-(3-borono-5-nitrobenzoyl)oxy-2,3,5,6-tetrachlorophenoxy]carbonyl-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 11319638 |
| Molecular Formula | C20H10B2Cl4N2O12 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 631.92 |
| IUPAC Name | [3-[4-(3-borono-5-nitrobenzoyl)oxy-2,3,5,6-tetrachlorophenoxy]carbonyl-5-nitrophenyl]boronic acid |
| SMILES | O=C(Oc1c(Cl)c(Cl)c(OC(=O)c2cc(B(O)O)cc([N+](=O)[O-])c2)c(Cl)c1Cl)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H10B2Cl4N2O12/c23-13-15(25)18(40-20(30)8-2-10(22(33)34)6-12(4-8)28(37)38)16(26)14(24)17(13)39-19(29)7-1-9(21(31)32)5-11(3-7)27(35)36/h1-6,31-34H |
| InChIKey | INPLMBUIYOEORX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 219.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|