C17H14BNO8 — CID 143045547
[3-[(3-methyl-2-oxo-3,4-dihydrochromen-4-yl)oxycarbonyl]-5-nitrophenyl]boronic acid (PubChem CID 143045547) has the molecular formula C17H14BNO8 and a molecular weight of 371.11 g/mol. Its IUPAC name is [3-[(3-methyl-2-oxo-3,4-dihydrochromen-4-yl)oxycarbonyl]-5-nitrophenyl]boronic acid.
| Compound Name | [3-[(3-methyl-2-oxo-3,4-dihydrochromen-4-yl)oxycarbonyl]-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 143045547 |
| Molecular Formula | C17H14BNO8 |
| Molecular Weight | 371.11 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [3-[(3-methyl-2-oxo-3,4-dihydrochromen-4-yl)oxycarbonyl]-5-nitrophenyl]boronic acid |
| SMILES | CC1C(=O)Oc2ccccc2C1OC(=O)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14BNO8/c1-9-15(13-4-2-3-5-14(13)26-16(9)20)27-17(21)10-6-11(18(22)23)8-12(7-10)19(24)25/h2-9,15,22-23H,1H3 |
| InChIKey | OQCSTUWVJVGXTQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|