C21H18N2O8 — CID 139039074
[(1S,5Z,8S)-1-methyl-4-oxo-1,2,7,8-tetrahydro-3-benzoxecin-8-yl] 3,5-dinitrobenzoate (PubChem CID 139039074) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is [(1S,5Z,8S)-1-methyl-4-oxo-1,2,7,8-tetrahydro-3-benzoxecin-8-yl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,5Z,8S)-1-methyl-4-oxo-1,2,7,8-tetrahydro-3-benzoxecin-8-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139039074 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [(1S,5Z,8S)-1-methyl-4-oxo-1,2,7,8-tetrahydro-3-benzoxecin-8-yl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H]1COC(=O)/C=C\C[C@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O8/c1-13-12-30-20(24)8-4-7-19(18-6-3-2-5-17(13)18)31-21(25)14-9-15(22(26)27)11-16(10-14)23(28)29/h2-6,8-11,13,19H,7,12H2,1H3/b8-4-/t13-,19+/m1/s1 |
| InChIKey | PZTVLUGYAWOWTB-UZGJAOCOSA-N |
| XLogP | 4.01 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|