C26H15NO4 — CID 44554728
3-(4-methyl-2-oxo-9-phenylfuro[2,3-h]chromene-8-carbonyl)benzonitrile (PubChem CID 44554728) has the molecular formula C26H15NO4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-9-phenylfuro[2,3-h]chromene-8-carbonyl)benzonitrile.
| Compound Name | 3-(4-methyl-2-oxo-9-phenylfuro[2,3-h]chromene-8-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 44554728 |
| Molecular Formula | C26H15NO4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(4-methyl-2-oxo-9-phenylfuro[2,3-h]chromene-8-carbonyl)benzonitrile |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(C#N)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H15NO4/c1-15-12-21(28)31-25-19(15)10-11-20-23(25)22(17-7-3-2-4-8-17)26(30-20)24(29)18-9-5-6-16(13-18)14-27/h2-13H,1H3 |
| InChIKey | FYUBLJJZBQNXND-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 84.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|