C29H25NO5 — CID 44552830
8-[3-[2-(dimethylamino)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 44552830) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is 8-[3-[2-(dimethylamino)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-[3-[2-(dimethylamino)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 44552830 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 8-[3-[2-(dimethylamino)ethoxy]benzoyl]-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(C(=O)c3cccc(OCCN(C)C)c3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C29H25NO5/c1-18-16-24(31)35-28-22(18)12-13-23-26(28)25(19-8-5-4-6-9-19)29(34-23)27(32)20-10-7-11-21(17-20)33-15-14-30(2)3/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | ZLIDGLUMLZRHIN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|