C35H36O5 — CID 58008457
8-(3-decoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one (PubChem CID 58008457) has the molecular formula C35H36O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is 8-(3-decoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 8-(3-decoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 58008457 |
| Molecular Formula | C35H36O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 8-(3-decoxybenzoyl)-4-methyl-9-phenylfuro[2,3-h]chromen-2-one |
| SMILES | CCCCCCCCCCOc1cccc(C(=O)c2oc3ccc4c(C)cc(=O)oc4c3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C35H36O5/c1-3-4-5-6-7-8-9-13-21-38-27-18-14-17-26(23-27)33(37)35-31(25-15-11-10-12-16-25)32-29(39-35)20-19-28-24(2)22-30(36)40-34(28)32/h10-12,14-20,22-23H,3-9,13,21H2,1-2H3 |
| InChIKey | HTSLZSVBAMQYEH-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|